About 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid
6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 123377621) has the molecular formula C10H13FO3
and a molecular weight of 200.21 g/mol. Its IUPAC name is 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid.
Analyze 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid (CID 123377621) is 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid is CCOC1C(C(=O)O)=CC=C(F)C1C.
What is the InChIKey of 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is YLXAJERUGIPAQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FO3/c1-3-14-9-6(2)8(11)5-4-7(9)10(12)13/h4-6,9H,3H2,1-2H3,(H,12,13).
What are the key properties of 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid?
6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 200.21 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 123377621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).