6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid

C10H13FO3 — CID 123377621

IUPAC6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid
SMILESCCOC1C(C(=O)O)=CC=C(F)C1C
InChIInChI=1S/C10H13FO3/c1-3-14-9-6(2)8(11)5-4-7(9)10(12)13/h4-6,9H,3H2,1-2H3,(H,12,13)
InChIKeyYLXAJERUGIPAQQ-UHFFFAOYSA-N
MW200.21 g/mol
LogP1.91
Rot. Bonds3

About 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid

6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 123377621) has the molecular formula C10H13FO3 and a molecular weight of 200.21 g/mol. Its IUPAC name is 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid.

Molecular Properties

Compound Name6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid
PubChem CID123377621
Molecular FormulaC10H13FO3
Molecular Weight200.21 g/mol
Exact Mass200.08
IUPAC Name6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid
SMILESCCOC1C(C(=O)O)=CC=C(F)C1C
InChIInChI=1S/C10H13FO3/c1-3-14-9-6(2)8(11)5-4-7(9)10(12)13/h4-6,9H,3H2,1-2H3,(H,12,13)
InChIKeyYLXAJERUGIPAQQ-UHFFFAOYSA-N
XLogP1.91
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.21
LogP ≤ 51.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid (CID 123377621) is 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid is CCOC1C(C(=O)O)=CC=C(F)C1C.
What is the InChIKey of 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is YLXAJERUGIPAQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FO3/c1-3-14-9-6(2)8(11)5-4-7(9)10(12)13/h4-6,9H,3H2,1-2H3,(H,12,13).
What are the key properties of 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid?
6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 200.21 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-4-fluoro-5-methylcyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 123377621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).