About methyl 6-hydroxycyclohexa-1,3-diene-1-carboxylate
methyl 6-hydroxycyclohexa-1,3-diene-1-carboxylate (PubChem CID 12625500) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is methyl 6-hydroxycyclohexa-1,3-diene-1-carboxylate.
Analyze methyl 6-hydroxycyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-hydroxycyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of methyl 6-hydroxycyclohexa-1,3-diene-1-carboxylate (CID 12625500) is methyl 6-hydroxycyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl 6-hydroxycyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for methyl 6-hydroxycyclohexa-1,3-diene-1-carboxylate is COC(=O)C1=CC=CCC1O.
What is the InChIKey of methyl 6-hydroxycyclohexa-1,3-diene-1-carboxylate?
The InChIKey is CRMOZBYBHBKJJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-11-8(10)6-4-2-3-5-7(6)9/h2-4,7,9H,5H2,1H3.
What are the key properties of methyl 6-hydroxycyclohexa-1,3-diene-1-carboxylate?
methyl 6-hydroxycyclohexa-1,3-diene-1-carboxylate has a molecular weight of 154.16 g/mol, XLogP of 0.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-hydroxycyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 12625500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).