C14H15F3O3 — CID 143131527
(5Z)-5-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid (PubChem CID 143131527) has the molecular formula C14H15F3O3 and a molecular weight of 288.27 g/mol. Its IUPAC name is (5Z)-5-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid.
| Compound Name | (5Z)-5-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid |
|---|---|
| PubChem CID | 143131527 |
| Molecular Formula | C14H15F3O3 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (5Z)-5-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid |
| SMILES | C=C(C)/C=C(C)\C=C1\C=C(C(=O)O)C(C(F)(F)F)OC1 |
| InChI | InChI=1S/C14H15F3O3/c1-8(2)4-9(3)5-10-6-11(13(18)19)12(20-7-10)14(15,16)17/h4-6,12H,1,7H2,2-3H3,(H,18,19)/b9-4-,10-5- |
| InChIKey | CLHDEKZWXGFDQZ-AVWDGMTFSA-N |
| XLogP | 3.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|