C15H19ClN4OS — CID 123379347
4-(3-chloro-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-11-yl)-N,N-dimethylbutanamide (PubChem CID 123379347) has the molecular formula C15H19ClN4OS and a molecular weight of 338.86 g/mol. Its IUPAC name is 4-(3-chloro-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-11-yl)-N,N-dimethylbutanamide.
| Compound Name | 4-(3-chloro-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-11-yl)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 123379347 |
| Molecular Formula | C15H19ClN4OS |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 4-(3-chloro-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-11-yl)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCN1CCc2c(sc3ncnc(Cl)c23)C1 |
| InChI | InChI=1S/C15H19ClN4OS/c1-19(2)12(21)4-3-6-20-7-5-10-11(8-20)22-15-13(10)14(16)17-9-18-15/h9H,3-8H2,1-2H3 |
| InChIKey | JGWKGQCQDCPAGL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |