C23H36O15 — CID 123382025
3-[3-acetyloxy-6-(acetyloxymethyl)-5-[6-(acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-4-hydroxyoxan-2-yl]propyl acetate (PubChem CID 123382025) has the molecular formula C23H36O15 and a molecular weight of 552.53 g/mol. Its IUPAC name is 3-[3-acetyloxy-6-(acetyloxymethyl)-5-[6-(acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-4-hydroxyoxan-2-yl]propyl acetate.
| Compound Name | 3-[3-acetyloxy-6-(acetyloxymethyl)-5-[6-(acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-4-hydroxyoxan-2-yl]propyl acetate |
|---|---|
| PubChem CID | 123382025 |
| Molecular Formula | C23H36O15 |
| Molecular Weight | 552.53 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 3-[3-acetyloxy-6-(acetyloxymethyl)-5-[6-(acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-4-hydroxyoxan-2-yl]propyl acetate |
| SMILES | CC(=O)OCCCC1OC(COC(C)=O)C(OC2OC(COC(C)=O)C(O)C(O)C2O)C(O)C1OC(C)=O |
| InChI | InChI=1S/C23H36O15/c1-10(24)32-7-5-6-14-21(35-13(4)27)20(31)22(16(36-14)9-34-12(3)26)38-23-19(30)18(29)17(28)15(37-23)8-33-11(2)25/h14-23,28-31H,5-9H2,1-4H3 |
| InChIKey | ACBJBSNKULDYFJ-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 213.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.53 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|