C15H13N3O2 — CID 123382085
(2Z)-5-cyclopropylimino-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolan-3-one (PubChem CID 123382085) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is (2Z)-5-cyclopropylimino-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolan-3-one.
| Compound Name | (2Z)-5-cyclopropylimino-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolan-3-one |
|---|---|
| PubChem CID | 123382085 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (2Z)-5-cyclopropylimino-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolan-3-one |
| SMILES | O=C1C/C(=N\C2CC2)O/C1=C\c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C15H13N3O2/c19-12-7-14(18-10-3-4-10)20-13(12)6-9-8-17-15-11(9)2-1-5-16-15/h1-2,5-6,8,10H,3-4,7H2,(H,16,17)/b13-6-,18-14+ |
| InChIKey | SSNBBDKBMPQJJD-YKWUFQCZSA-N |
| XLogP | 2.45 |
| TPSA | 67.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|