C21H16N4O6 — CID 123475114
ethyl (5Z)-2-(4-nitrophenyl)imino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate (PubChem CID 123475114) has the molecular formula C21H16N4O6 and a molecular weight of 420.38 g/mol. Its IUPAC name is ethyl (5Z)-2-(4-nitrophenyl)imino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate.
| Compound Name | ethyl (5Z)-2-(4-nitrophenyl)imino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate |
|---|---|
| PubChem CID | 123475114 |
| Molecular Formula | C21H16N4O6 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | ethyl (5Z)-2-(4-nitrophenyl)imino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)/C(=C/c2c[nH]c3ncccc23)O/C1=N\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H16N4O6/c1-2-30-21(27)17-18(26)16(10-12-11-23-19-15(12)4-3-9-22-19)31-20(17)24-13-5-7-14(8-6-13)25(28)29/h3-11,17H,2H2,1H3,(H,22,23)/b16-10-,24-20- |
| InChIKey | SSXZSCBMRYZQLY-SJJWAQBGSA-N |
| XLogP | 3.32 |
| TPSA | 136.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|