C10H15BrF3N — CID 123383683
4-bromo-N-methyl-N-(3,3,3-trifluoropropyl)hexa-2,4-dien-2-amine (PubChem CID 123383683) has the molecular formula C10H15BrF3N and a molecular weight of 286.13 g/mol. Its IUPAC name is 4-bromo-N-methyl-N-(3,3,3-trifluoropropyl)hexa-2,4-dien-2-amine.
| Compound Name | 4-bromo-N-methyl-N-(3,3,3-trifluoropropyl)hexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 123383683 |
| Molecular Formula | C10H15BrF3N |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 4-bromo-N-methyl-N-(3,3,3-trifluoropropyl)hexa-2,4-dien-2-amine |
| SMILES | CC=C(Br)C=C(C)N(C)CCC(F)(F)F |
| InChI | InChI=1S/C10H15BrF3N/c1-4-9(11)7-8(2)15(3)6-5-10(12,13)14/h4,7H,5-6H2,1-3H3 |
| InChIKey | RPIXIERANROMQJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|