C9H14BrF2N — CID 123855399
4-bromo-N-(2,2-difluoroethyl)-N-methylhexa-2,4-dien-2-amine (PubChem CID 123855399) has the molecular formula C9H14BrF2N and a molecular weight of 254.12 g/mol. Its IUPAC name is 4-bromo-N-(2,2-difluoroethyl)-N-methylhexa-2,4-dien-2-amine.
| Compound Name | 4-bromo-N-(2,2-difluoroethyl)-N-methylhexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 123855399 |
| Molecular Formula | C9H14BrF2N |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 4-bromo-N-(2,2-difluoroethyl)-N-methylhexa-2,4-dien-2-amine |
| SMILES | CC=C(Br)C=C(C)N(C)CC(F)F |
| InChI | InChI=1S/C9H14BrF2N/c1-4-8(10)5-7(2)13(3)6-9(11)12/h4-5,9H,6H2,1-3H3 |
| InChIKey | JWDARSRZAJRXHH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|