C10H16BrF2N — CID 123486641
5-bromo-N-(2,2-difluoroethyl)-N-methylhepta-3,5-dien-3-amine (PubChem CID 123486641) has the molecular formula C10H16BrF2N and a molecular weight of 268.14 g/mol. Its IUPAC name is 5-bromo-N-(2,2-difluoroethyl)-N-methylhepta-3,5-dien-3-amine.
| Compound Name | 5-bromo-N-(2,2-difluoroethyl)-N-methylhepta-3,5-dien-3-amine |
|---|---|
| PubChem CID | 123486641 |
| Molecular Formula | C10H16BrF2N |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 5-bromo-N-(2,2-difluoroethyl)-N-methylhepta-3,5-dien-3-amine |
| SMILES | CC=C(Br)C=C(CC)N(C)CC(F)F |
| InChI | InChI=1S/C10H16BrF2N/c1-4-8(11)6-9(5-2)14(3)7-10(12)13/h4,6,10H,5,7H2,1-3H3 |
| InChIKey | MUZKXKHRSUJKNG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|