C11H17F2N — CID 177135534
(3Z)-2,2-difluoro-N,5-dimethyl-N-prop-1-en-2-ylhexa-3,5-dien-3-amine (PubChem CID 177135534) has the molecular formula C11H17F2N and a molecular weight of 201.26 g/mol. Its IUPAC name is (3Z)-2,2-difluoro-N,5-dimethyl-N-prop-1-en-2-ylhexa-3,5-dien-3-amine.
| Compound Name | (3Z)-2,2-difluoro-N,5-dimethyl-N-prop-1-en-2-ylhexa-3,5-dien-3-amine |
|---|---|
| PubChem CID | 177135534 |
| Molecular Formula | C11H17F2N |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | (3Z)-2,2-difluoro-N,5-dimethyl-N-prop-1-en-2-ylhexa-3,5-dien-3-amine |
| SMILES | C=C(C)/C=C(\N(C)C(=C)C)C(C)(F)F |
| InChI | InChI=1S/C11H17F2N/c1-8(2)7-10(11(5,12)13)14(6)9(3)4/h7H,1,3H2,2,4-6H3/b10-7- |
| InChIKey | YUHLLDLOFSKCPW-YFHOEESVSA-N |
| XLogP | 3.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|