C9H13F3N+ — CID 174278721
cyclopenta-1,3-dien-1-yl-dimethyl-(2,2,2-trifluoroethyl)azanium (PubChem CID 174278721) has the molecular formula C9H13F3N+ and a molecular weight of 192.20 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yl-dimethyl-(2,2,2-trifluoroethyl)azanium.
| Compound Name | cyclopenta-1,3-dien-1-yl-dimethyl-(2,2,2-trifluoroethyl)azanium |
|---|---|
| PubChem CID | 174278721 |
| Molecular Formula | C9H13F3N+ |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | cyclopenta-1,3-dien-1-yl-dimethyl-(2,2,2-trifluoroethyl)azanium |
| SMILES | C[N+](C)(CC(F)(F)F)C1=CC=CC1 |
| InChI | InChI=1S/C9H13F3N/c1-13(2,7-9(10,11)12)8-5-3-4-6-8/h3-5H,6-7H2,1-2H3/q+1 |
| InChIKey | RXBAZMDSJGSDSQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|