C10H17F4N — CID 145356124
ethane;(2E)-4-fluoro-N-methyl-N-(2,2,2-trifluoroethyl)penta-2,4-dien-2-amine (PubChem CID 145356124) has the molecular formula C10H17F4N and a molecular weight of 227.24 g/mol. Its IUPAC name is ethane;(2E)-4-fluoro-N-methyl-N-(2,2,2-trifluoroethyl)penta-2,4-dien-2-amine.
| Compound Name | ethane;(2E)-4-fluoro-N-methyl-N-(2,2,2-trifluoroethyl)penta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 145356124 |
| Molecular Formula | C10H17F4N |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | ethane;(2E)-4-fluoro-N-methyl-N-(2,2,2-trifluoroethyl)penta-2,4-dien-2-amine |
| SMILES | C=C(F)/C=C(\C)N(C)CC(F)(F)F.CC |
| InChI | InChI=1S/C8H11F4N.C2H6/c1-6(9)4-7(2)13(3)5-8(10,11)12;1-2/h4H,1,5H2,2-3H3;1-2H3/b7-4+; |
| InChIKey | VZGDSGDNVBBOKQ-KQGICBIGSA-N |
| XLogP | 3.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|