C11H19F2N — CID 156741113
(2E,4Z)-N-(3,3-difluorobutan-2-yl)-N-methylhexa-2,4-dien-2-amine (PubChem CID 156741113) has the molecular formula C11H19F2N and a molecular weight of 203.28 g/mol. Its IUPAC name is (2E,4Z)-N-(3,3-difluorobutan-2-yl)-N-methylhexa-2,4-dien-2-amine.
| Compound Name | (2E,4Z)-N-(3,3-difluorobutan-2-yl)-N-methylhexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 156741113 |
| Molecular Formula | C11H19F2N |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | (2E,4Z)-N-(3,3-difluorobutan-2-yl)-N-methylhexa-2,4-dien-2-amine |
| SMILES | C/C=C\C=C(/C)N(C)C(C)C(C)(F)F |
| InChI | InChI=1S/C11H19F2N/c1-6-7-8-9(2)14(5)10(3)11(4,12)13/h6-8,10H,1-5H3/b7-6-,9-8+ |
| InChIKey | YJCZJJFJMXJDIQ-NMMTYZSQSA-N |
| XLogP | 3.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|