C18H14FN3O3 — CID 123383850
3-fluoro-N-[2-oxo-2-[(2E)-2-(2-oxo-3H-inden-1-ylidene)hydrazinyl]ethyl]benzamide (PubChem CID 123383850) has the molecular formula C18H14FN3O3 and a molecular weight of 339.33 g/mol. Its IUPAC name is 3-fluoro-N-[2-oxo-2-[(2E)-2-(2-oxo-3H-inden-1-ylidene)hydrazinyl]ethyl]benzamide.
| Compound Name | 3-fluoro-N-[2-oxo-2-[(2E)-2-(2-oxo-3H-inden-1-ylidene)hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 123383850 |
| Molecular Formula | C18H14FN3O3 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 3-fluoro-N-[2-oxo-2-[(2E)-2-(2-oxo-3H-inden-1-ylidene)hydrazinyl]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(F)c1)N/N=C1/C(=O)Cc2ccccc21 |
| InChI | InChI=1S/C18H14FN3O3/c19-13-6-3-5-12(8-13)18(25)20-10-16(24)21-22-17-14-7-2-1-4-11(14)9-15(17)23/h1-8H,9-10H2,(H,20,25)(H,21,24)/b22-17+ |
| InChIKey | ZMYHNFYXDIQLEJ-OQKWZONESA-N |
| XLogP | 1.20 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|