C28H51FN7O2+ — CID 123386044
3,3-diamino-2-(1-ethyl-6-fluoro-4,8-dimethyl-4-azoniabicyclo[6.1.0]non-4-en-3-yl)-N-[4-[4-(oxolan-3-yl)piperazin-1-yl]piperidin-3-yl]propanamide (PubChem CID 123386044) has the molecular formula C28H51FN7O2+ and a molecular weight of 536.76 g/mol. Its IUPAC name is 3,3-diamino-2-(1-ethyl-6-fluoro-4,8-dimethyl-4-azoniabicyclo[6.1.0]non-4-en-3-yl)-N-[4-[4-(oxolan-3-yl)piperazin-1-yl]piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(1-ethyl-6-fluoro-4,8-dimethyl-4-azoniabicyclo[6.1.0]non-4-en-3-yl)-N-[4-[4-(oxolan-3-yl)piperazin-1-yl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123386044 |
| Molecular Formula | C28H51FN7O2+ |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.41 |
| IUPAC Name | 3,3-diamino-2-(1-ethyl-6-fluoro-4,8-dimethyl-4-azoniabicyclo[6.1.0]non-4-en-3-yl)-N-[4-[4-(oxolan-3-yl)piperazin-1-yl]piperidin-3-yl]propanamide |
| SMILES | CCC12CC(C(C(=O)NC3CNCCC3N3CCN(C4CCOC4)CC3)C(N)N)/[N+](C)=C\C(F)CC1(C)C2 |
| InChI | InChI=1S/C28H50FN7O2/c1-4-28-14-23(34(3)16-19(29)13-27(28,2)18-28)24(25(30)31)26(37)33-21-15-32-7-5-22(21)36-10-8-35(9-11-36)20-6-12-38-17-20/h16,19-25,32H,4-15,17-18,30-31H2,1-3H3/p+1/b34-16- |
| InChIKey | YKKKMWOVQKXUBB-MJXLXAJKSA-O |
| XLogP | 0.12 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|