C32H31FN4O6 — CID 123387630
N-but-2-en-2-yl-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-methoxyphenyl]-N-(4-fluorophenyl)-2-methyliminopropanediamide (PubChem CID 123387630) has the molecular formula C32H31FN4O6 and a molecular weight of 586.62 g/mol. Its IUPAC name is N-but-2-en-2-yl-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-methoxyphenyl]-N-(4-fluorophenyl)-2-methyliminopropanediamide.
| Compound Name | N-but-2-en-2-yl-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-methoxyphenyl]-N-(4-fluorophenyl)-2-methyliminopropanediamide |
|---|---|
| PubChem CID | 123387630 |
| Molecular Formula | C32H31FN4O6 |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | N-but-2-en-2-yl-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-methoxyphenyl]-N-(4-fluorophenyl)-2-methyliminopropanediamide |
| SMILES | CC=C(C)N(C(=O)/C(=N/C)C(=O)Nc1ccc(Oc2ccnc3cc(OC)c(OC)cc23)cc1OC)c1ccc(F)cc1 |
| InChI | InChI=1S/C32H31FN4O6/c1-7-19(2)37(21-10-8-20(33)9-11-21)32(39)30(34-3)31(38)36-24-13-12-22(16-27(24)40-4)43-26-14-15-35-25-18-29(42-6)28(41-5)17-23(25)26/h7-18H,1-6H3,(H,36,38)/b19-7?,34-30+ |
| InChIKey | RPZWNGSDVYEACT-QSFFWDNWSA-N |
| XLogP | 6.16 |
| TPSA | 111.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|