C32H37NO9 — CID 123388174
(10,11-dihydroxy-13,13-dimethyl-19-methylidene-8,16-dioxo-18-oxahexacyclo[8.6.2.15,7.01,12.02,9.06,9]nonadecan-7-yl) 1-(furan-2-carbonyl)piperidine-4-carboxylate (PubChem CID 123388174) has the molecular formula C32H37NO9 and a molecular weight of 579.65 g/mol. Its IUPAC name is (10,11-dihydroxy-13,13-dimethyl-19-methylidene-8,16-dioxo-18-oxahexacyclo[8.6.2.15,7.01,12.02,9.06,9]nonadecan-7-yl) 1-(furan-2-carbonyl)piperidine-4-carboxylate.
| Compound Name | (10,11-dihydroxy-13,13-dimethyl-19-methylidene-8,16-dioxo-18-oxahexacyclo[8.6.2.15,7.01,12.02,9.06,9]nonadecan-7-yl) 1-(furan-2-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 123388174 |
| Molecular Formula | C32H37NO9 |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | (10,11-dihydroxy-13,13-dimethyl-19-methylidene-8,16-dioxo-18-oxahexacyclo[8.6.2.15,7.01,12.02,9.06,9]nonadecan-7-yl) 1-(furan-2-carbonyl)piperidine-4-carboxylate |
| SMILES | C=C1C2CCC3C45COC(O)(C(O)C4C(C)(C)CCC5=O)C34C(=O)C1(OC(=O)C1CCN(C(=O)c3ccco3)CC1)C24 |
| InChI | InChI=1S/C32H37NO9/c1-16-18-6-7-20-29-15-41-32(39,24(35)23(29)28(2,3)11-8-21(29)34)30(20)22(18)31(16,27(30)38)42-26(37)17-9-12-33(13-10-17)25(36)19-5-4-14-40-19/h4-5,14,17-18,20,22-24,35,39H,1,6-13,15H2,2-3H3 |
| InChIKey | LCGYNQRISWEGNS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|