C30H25Cl2N9O3 — CID 123388214
methyl N-[4-[6-[2-(4-aminophenyl)-1-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]ethyl]-3-chloropyridazin-4-yl]phenyl]carbamate (PubChem CID 123388214) has the molecular formula C30H25Cl2N9O3 and a molecular weight of 630.50 g/mol. Its IUPAC name is methyl N-[4-[6-[2-(4-aminophenyl)-1-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]ethyl]-3-chloropyridazin-4-yl]phenyl]carbamate.
| Compound Name | methyl N-[4-[6-[2-(4-aminophenyl)-1-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]ethyl]-3-chloropyridazin-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 123388214 |
| Molecular Formula | C30H25Cl2N9O3 |
| Molecular Weight | 630.50 g/mol |
| Exact Mass | 629.15 |
| IUPAC Name | methyl N-[4-[6-[2-(4-aminophenyl)-1-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]ethyl]-3-chloropyridazin-4-yl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(-c2cc(C(Cc3ccc(N)cc3)NC(=O)C=Cc3cc(Cl)ccc3-n3cnnn3)nnc2Cl)cc1 |
| InChI | InChI=1S/C30H25Cl2N9O3/c1-44-30(43)35-23-10-4-19(5-11-23)24-16-26(37-38-29(24)32)25(14-18-2-8-22(33)9-3-18)36-28(42)13-6-20-15-21(31)7-12-27(20)41-17-34-39-40-41/h2-13,15-17,25H,14,33H2,1H3,(H,35,43)(H,36,42) |
| InChIKey | OBZIGKIIBVGMNP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 162.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|