C30H23Cl2IN8O3 — CID 163839000
methyl N-[4-[3-chloro-6-[(1S)-1-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-2-(3-iodophenyl)ethyl]pyridazin-4-yl]phenyl]carbamate (PubChem CID 163839000) has the molecular formula C30H23Cl2IN8O3 and a molecular weight of 741.38 g/mol. Its IUPAC name is methyl N-[4-[3-chloro-6-[(1S)-1-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-2-(3-iodophenyl)ethyl]pyridazin-4-yl]phenyl]carbamate.
| Compound Name | methyl N-[4-[3-chloro-6-[(1S)-1-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-2-(3-iodophenyl)ethyl]pyridazin-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 163839000 |
| Molecular Formula | C30H23Cl2IN8O3 |
| Molecular Weight | 741.38 g/mol |
| Exact Mass | 740.03 |
| IUPAC Name | methyl N-[4-[3-chloro-6-[(1S)-1-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-2-(3-iodophenyl)ethyl]pyridazin-4-yl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(-c2cc([C@H](Cc3cccc(I)c3)NC(=O)/C=C/c3cc(Cl)ccc3-n3cnnn3)nnc2Cl)cc1 |
| InChI | InChI=1S/C30H23Cl2IN8O3/c1-44-30(43)35-23-9-5-19(6-10-23)24-16-26(37-38-29(24)32)25(14-18-3-2-4-22(33)13-18)36-28(42)12-7-20-15-21(31)8-11-27(20)41-17-34-39-40-41/h2-13,15-17,25H,14H2,1H3,(H,35,43)(H,36,42)/b12-7+/t25-/m0/s1 |
| InChIKey | OKGGMRLIAQWHEY-FRHHVXPKSA-N |
| XLogP | 6.32 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.38 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|