C28H27Cl2N9O3 — CID 174632985
methyl N-[4-[3-chloro-6-[1-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-5-imino-3-methylpentyl]pyridazin-4-yl]phenyl]carbamate (PubChem CID 174632985) has the molecular formula C28H27Cl2N9O3 and a molecular weight of 608.49 g/mol. Its IUPAC name is methyl N-[4-[3-chloro-6-[1-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-5-imino-3-methylpentyl]pyridazin-4-yl]phenyl]carbamate.
| Compound Name | methyl N-[4-[3-chloro-6-[1-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-5-imino-3-methylpentyl]pyridazin-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 174632985 |
| Molecular Formula | C28H27Cl2N9O3 |
| Molecular Weight | 608.49 g/mol |
| Exact Mass | 607.16 |
| IUPAC Name | methyl N-[4-[3-chloro-6-[1-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-5-imino-3-methylpentyl]pyridazin-4-yl]phenyl]carbamate |
| SMILES | [H]/N=C\CC(C)CC(NC(=O)/C=C/c1cc(Cl)ccc1-n1cnnn1)c1cc(-c2ccc(NC(=O)OC)cc2)c(Cl)nn1 |
| InChI | InChI=1S/C28H27Cl2N9O3/c1-17(11-12-31)13-23(34-26(40)10-5-19-14-20(29)6-9-25(19)39-16-32-37-38-39)24-15-22(27(30)36-35-24)18-3-7-21(8-4-18)33-28(41)42-2/h3-10,12,14-17,23,31H,11,13H2,1-2H3,(H,33,41)(H,34,40)/b10-5+,31-12- |
| InChIKey | ZSWFRRZRUNSMIF-VFZFWCICSA-N |
| XLogP | 5.54 |
| TPSA | 160.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|