C37H32F6N4O4+2 — CID 123389190
5-[3-[4-[5-oxo-1-[4-(trifluoromethoxy)anilino]penta-1,3-dien-3-yl]pyridin-1-ium-1-yl]propylamino]-3-[1-[4-(trifluoromethoxy)phenyl]pyridin-1-ium-4-yl]penta-2,4-dienal (PubChem CID 123389190) has the molecular formula C37H32F6N4O4+2 and a molecular weight of 710.68 g/mol. Its IUPAC name is 5-[3-[4-[5-oxo-1-[4-(trifluoromethoxy)anilino]penta-1,3-dien-3-yl]pyridin-1-ium-1-yl]propylamino]-3-[1-[4-(trifluoromethoxy)phenyl]pyridin-1-ium-4-yl]penta-2,4-dienal.
| Compound Name | 5-[3-[4-[5-oxo-1-[4-(trifluoromethoxy)anilino]penta-1,3-dien-3-yl]pyridin-1-ium-1-yl]propylamino]-3-[1-[4-(trifluoromethoxy)phenyl]pyridin-1-ium-4-yl]penta-2,4-dienal |
|---|---|
| PubChem CID | 123389190 |
| Molecular Formula | C37H32F6N4O4+2 |
| Molecular Weight | 710.68 g/mol |
| Exact Mass | 710.23 |
| IUPAC Name | 5-[3-[4-[5-oxo-1-[4-(trifluoromethoxy)anilino]penta-1,3-dien-3-yl]pyridin-1-ium-1-yl]propylamino]-3-[1-[4-(trifluoromethoxy)phenyl]pyridin-1-ium-4-yl]penta-2,4-dienal |
| SMILES | O=CC=C(C=CNc1ccc(OC(F)(F)F)cc1)c1cc[n+](CCCNC=CC(=CC=O)c2cc[n+](-c3ccc(OC(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H30F6N4O4/c38-36(39,40)50-34-6-2-32(3-7-34)45-20-11-29(17-27-49)30-12-22-46(23-13-30)21-1-18-44-19-10-28(16-26-48)31-14-24-47(25-15-31)33-4-8-35(9-5-33)51-37(41,42)43/h2-17,19-20,22-27H,1,18,21H2/p+2 |
| InChIKey | KXRCRHZKCGDUOV-UHFFFAOYSA-P |
| XLogP | 7.03 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.68 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|