C7H8 — CID 123390029
tricyclo[4.1.0.02,4]hept-1(6)-ene (PubChem CID 123390029) has the molecular formula C7H8 and a molecular weight of 92.14 g/mol. Its IUPAC name is tricyclo[4.1.0.02,4]hept-1(6)-ene.
| Compound Name | tricyclo[4.1.0.02,4]hept-1(6)-ene |
|---|---|
| PubChem CID | 123390029 |
| Molecular Formula | C7H8 |
| Molecular Weight | 92.14 g/mol |
| Exact Mass | 92.06 |
| IUPAC Name | tricyclo[4.1.0.02,4]hept-1(6)-ene |
| SMILES | C1C2=C1C1CC1C2 |
| InChI | InChI=1S/C7H8/c1-4-2-6(4)7-3-5(1)7/h4,6H,1-3H2 |
| InChIKey | YOOOKRSRQALPCJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 92.14 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|