C10H14 — CID 147975806
1,2,3,4,5,5a,6,6a-octahydrocyclopropa[a]indene (PubChem CID 147975806) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is 1,2,3,4,5,5a,6,6a-octahydrocyclopropa[a]indene.
| Compound Name | 1,2,3,4,5,5a,6,6a-octahydrocyclopropa[a]indene |
|---|---|
| PubChem CID | 147975806 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 1,2,3,4,5,5a,6,6a-octahydrocyclopropa[a]indene |
| SMILES | C1CCC2CC3CC3=C2C1 |
| InChI | InChI=1S/C10H14/c1-2-4-9-7(3-1)5-8-6-10(8)9/h7-8H,1-6H2 |
| InChIKey | ISGAYVAMLGOFIL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|