C9H12 — CID 147143618
(3S)-3-ethyltricyclo[4.1.0.02,4]hept-1(6)-ene (PubChem CID 147143618) has the molecular formula C9H12 and a molecular weight of 120.19 g/mol. Its IUPAC name is (3S)-3-ethyltricyclo[4.1.0.02,4]hept-1(6)-ene.
| Compound Name | (3S)-3-ethyltricyclo[4.1.0.02,4]hept-1(6)-ene |
|---|---|
| PubChem CID | 147143618 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | (3S)-3-ethyltricyclo[4.1.0.02,4]hept-1(6)-ene |
| SMILES | CC[C@H]1C2CC3=C(C3)C21 |
| InChI | InChI=1S/C9H12/c1-2-6-8-4-5-3-7(5)9(6)8/h6,8-9H,2-4H2,1H3/t6-,8?,9?/m0/s1 |
| InChIKey | BSPLDJLTYAOFIV-GVWIPJJGSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|