C22H24N7O3+ — CID 123394826
5-[3-[3-(4,4-dihydroxypiperazin-4-ium-1-yl)azetidin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine (PubChem CID 123394826) has the molecular formula C22H24N7O3+ and a molecular weight of 434.48 g/mol. Its IUPAC name is 5-[3-[3-(4,4-dihydroxypiperazin-4-ium-1-yl)azetidin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine.
| Compound Name | 5-[3-[3-(4,4-dihydroxypiperazin-4-ium-1-yl)azetidin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 123394826 |
| Molecular Formula | C22H24N7O3+ |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 5-[3-[3-(4,4-dihydroxypiperazin-4-ium-1-yl)azetidin-1-yl]quinoxalin-6-yl]-1,3-benzoxazol-2-amine |
| SMILES | Nc1nc2cc(-c3ccc4ncc(N5CC(N6CC[N+](O)(O)CC6)C5)nc4c3)ccc2o1 |
| InChI | InChI=1S/C22H24N7O3/c23-22-26-19-10-15(2-4-20(19)32-22)14-1-3-17-18(9-14)25-21(11-24-17)28-12-16(13-28)27-5-7-29(30,31)8-6-27/h1-4,9-11,16,30-31H,5-8,12-13H2,(H2,23,26)/q+1 |
| InChIKey | VVNNVKFCWSCPEQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|