C19H17N5O2 — CID 54675302
5-(6-morpholin-4-yl-1,5-naphthyridin-3-yl)-1,3-benzoxazol-2-amine (PubChem CID 54675302) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 5-(6-morpholin-4-yl-1,5-naphthyridin-3-yl)-1,3-benzoxazol-2-amine.
| Compound Name | 5-(6-morpholin-4-yl-1,5-naphthyridin-3-yl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 54675302 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 5-(6-morpholin-4-yl-1,5-naphthyridin-3-yl)-1,3-benzoxazol-2-amine |
| SMILES | Nc1nc2cc(-c3cnc4ccc(N5CCOCC5)nc4c3)ccc2o1 |
| InChI | InChI=1S/C19H17N5O2/c20-19-23-16-9-12(1-3-17(16)26-19)13-10-15-14(21-11-13)2-4-18(22-15)24-5-7-25-8-6-24/h1-4,9-11H,5-8H2,(H2,20,23) |
| InChIKey | AHFRRKNLYYOBMB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |