C24H29N7O2 — CID 144716901
2-(dimethylamino)acetaldehyde;5-[3-(4-methylpiperazin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine (PubChem CID 144716901) has the molecular formula C24H29N7O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-(dimethylamino)acetaldehyde;5-[3-(4-methylpiperazin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine.
| Compound Name | 2-(dimethylamino)acetaldehyde;5-[3-(4-methylpiperazin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 144716901 |
| Molecular Formula | C24H29N7O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 2-(dimethylamino)acetaldehyde;5-[3-(4-methylpiperazin-1-yl)quinoxalin-6-yl]-1,3-benzoxazol-2-amine |
| SMILES | CN(C)CC=O.CN1CCN(c2cnc3ccc(-c4ccc5oc(N)nc5c4)cc3n2)CC1 |
| InChI | InChI=1S/C20H20N6O.C4H9NO/c1-25-6-8-26(9-7-25)19-12-22-15-4-2-13(10-16(15)23-19)14-3-5-18-17(11-14)24-20(21)27-18;1-5(2)3-4-6/h2-5,10-12H,6-9H2,1H3,(H2,21,24);4H,3H2,1-2H3 |
| InChIKey | ULYNYFQLMXQIBY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|