About [7-(2-amino-1,3-benzoxazol-5-yl)quinoxalin-2-yl]-(4-methylpiperazin-1-yl)methanone
[7-(2-amino-1,3-benzoxazol-5-yl)quinoxalin-2-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 70798533) has the molecular formula C21H20N6O2
and a molecular weight of 388.43 g/mol. Its IUPAC name is [7-(2-amino-1,3-benzoxazol-5-yl)quinoxalin-2-yl]-(4-methylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | [7-(2-amino-1,3-benzoxazol-5-yl)quinoxalin-2-yl]-(4-methylpiperazin-1-yl)methanone |
| PubChem CID | 70798533 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | [7-(2-amino-1,3-benzoxazol-5-yl)quinoxalin-2-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cnc3ccc(-c4ccc5oc(N)nc5c4)cc3n2)CC1 |
| InChI | InChI=1S/C21H20N6O2/c1-26-6-8-27(9-7-26)20(28)18-12-23-15-4-2-13(10-16(15)24-18)14-3-5-19-17(11-14)25-21(22)29-19/h2-5,10-12H,6-9H2,1H3,(H2,22,25) |
| InChIKey | VSDZGXWYUWJVLL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [7-(2-amino-1,3-benzoxazol-5-yl)quinoxalin-2-yl]-(4-methylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(2-amino-1,3-benzoxazol-5-yl)quinoxalin-2-yl]-(4-methylpiperazin-1-yl)methanone?
The IUPAC name of [7-(2-amino-1,3-benzoxazol-5-yl)quinoxalin-2-yl]-(4-methylpiperazin-1-yl)methanone (CID 70798533) is [7-(2-amino-1,3-benzoxazol-5-yl)quinoxalin-2-yl]-(4-methylpiperazin-1-yl)methanone.
What is the SMILES notation for [7-(2-amino-1,3-benzoxazol-5-yl)quinoxalin-2-yl]-(4-methylpiperazin-1-yl)methanone?
The canonical SMILES for [7-(2-amino-1,3-benzoxazol-5-yl)quinoxalin-2-yl]-(4-methylpiperazin-1-yl)methanone is CN1CCN(C(=O)c2cnc3ccc(-c4ccc5oc(N)nc5c4)cc3n2)CC1.
What is the InChIKey of [7-(2-amino-1,3-benzoxazol-5-yl)quinoxalin-2-yl]-(4-methylpiperazin-1-yl)methanone?
The InChIKey is VSDZGXWYUWJVLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N6O2/c1-26-6-8-27(9-7-26)20(28)18-12-23-15-4-2-13(10-16(15)24-18)14-3-5-19-17(11-14)25-21(22)29-19/h2-5,10-12H,6-9H2,1H3,(H2,22,25).
What are the key properties of [7-(2-amino-1,3-benzoxazol-5-yl)quinoxalin-2-yl]-(4-methylpiperazin-1-yl)methanone?
[7-(2-amino-1,3-benzoxazol-5-yl)quinoxalin-2-yl]-(4-methylpiperazin-1-yl)methanone has a molecular weight of 388.43 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(2-amino-1,3-benzoxazol-5-yl)quinoxalin-2-yl]-(4-methylpiperazin-1-yl)methanone is sourced from PubChem (CID 70798533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).