C29H33NO4 — CID 123394965
1-(7-ethenyl-7-methoxy-3-methyl-9-phenylmethoxy-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl)ethanone (PubChem CID 123394965) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is 1-(7-ethenyl-7-methoxy-3-methyl-9-phenylmethoxy-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl)ethanone.
| Compound Name | 1-(7-ethenyl-7-methoxy-3-methyl-9-phenylmethoxy-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl)ethanone |
|---|---|
| PubChem CID | 123394965 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 1-(7-ethenyl-7-methoxy-3-methyl-9-phenylmethoxy-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl)ethanone |
| SMILES | C=CC1(OC)C(C(C)=O)CC2C3Cc4ccc(OCc5ccccc5)c5c4C2(CCN3C)C1O5 |
| InChI | InChI=1S/C29H33NO4/c1-5-29(32-4)21(18(2)31)16-22-23-15-20-11-12-24(33-17-19-9-7-6-8-10-19)26-25(20)28(22,27(29)34-26)13-14-30(23)3/h5-12,21-23,27H,1,13-17H2,2-4H3 |
| InChIKey | MKNALPFKBIBUNH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|