C28H30N2O3 — CID 144657628
acetylene;(6R,7aR)-7-methoxy-3-methyl-9-phenylmethoxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carbonitrile (PubChem CID 144657628) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is acetylene;(6R,7aR)-7-methoxy-3-methyl-9-phenylmethoxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carbonitrile.
| Compound Name | acetylene;(6R,7aR)-7-methoxy-3-methyl-9-phenylmethoxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carbonitrile |
|---|---|
| PubChem CID | 144657628 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | acetylene;(6R,7aR)-7-methoxy-3-methyl-9-phenylmethoxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carbonitrile |
| SMILES | C#C.COC1[C@@H](C#N)CC2C3Cc4ccc(OCc5ccccc5)c5c4C2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C26H28N2O3.C2H2/c1-28-11-10-26-19-12-18(14-27)23(29-2)25(26)31-24-21(30-15-16-6-4-3-5-7-16)9-8-17(22(24)26)13-20(19)28;1-2/h3-9,18-20,23,25H,10-13,15H2,1-2H3;1-2H/t18-,19?,20?,23?,25+,26?;/m1./s1 |
| InChIKey | OKNAHWSBVXJFRX-SMIRQOJJSA-N |
| XLogP | 3.95 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|