C29H35NO6 — CID 123901376
methyl 2-[7,9-dimethoxy-6-(phenylmethoxymethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]acetate (PubChem CID 123901376) has the molecular formula C29H35NO6 and a molecular weight of 493.60 g/mol. Its IUPAC name is methyl 2-[7,9-dimethoxy-6-(phenylmethoxymethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]acetate.
| Compound Name | methyl 2-[7,9-dimethoxy-6-(phenylmethoxymethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]acetate |
|---|---|
| PubChem CID | 123901376 |
| Molecular Formula | C29H35NO6 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | methyl 2-[7,9-dimethoxy-6-(phenylmethoxymethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]acetate |
| SMILES | COC(=O)CN1CCC23c4c5ccc(OC)c4OC2C(OC)C(COCc2ccccc2)CC3C1C5 |
| InChI | InChI=1S/C29H35NO6/c1-32-23-10-9-19-14-22-21-13-20(17-35-16-18-7-5-4-6-8-18)26(34-3)28-29(21,25(19)27(23)36-28)11-12-30(22)15-24(31)33-2/h4-10,20-22,26,28H,11-17H2,1-3H3 |
| InChIKey | GYSZNHTVTUJJBM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |