C32H38F3NO6S — CID 87171843
[(4R,6R,7aR,12bS)-3-(cyclopropylmethyl)-7-ethyl-7-methoxy-6-(phenylmethoxymethyl)-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] trifluoromethanesulfonate (PubChem CID 87171843) has the molecular formula C32H38F3NO6S and a molecular weight of 621.72 g/mol. Its IUPAC name is [(4R,6R,7aR,12bS)-3-(cyclopropylmethyl)-7-ethyl-7-methoxy-6-(phenylmethoxymethyl)-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] trifluoromethanesulfonate.
| Compound Name | [(4R,6R,7aR,12bS)-3-(cyclopropylmethyl)-7-ethyl-7-methoxy-6-(phenylmethoxymethyl)-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87171843 |
| Molecular Formula | C32H38F3NO6S |
| Molecular Weight | 621.72 g/mol |
| Exact Mass | 621.24 |
| IUPAC Name | [(4R,6R,7aR,12bS)-3-(cyclopropylmethyl)-7-ethyl-7-methoxy-6-(phenylmethoxymethyl)-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] trifluoromethanesulfonate |
| SMILES | CCC1(OC)[C@@H](COCc2ccccc2)CC2[C@H]3Cc4ccc(OS(=O)(=O)C(F)(F)F)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C32H38F3NO6S/c1-3-31(39-2)23(19-40-18-21-7-5-4-6-8-21)16-24-25-15-22-11-12-26(42-43(37,38)32(33,34)35)28-27(22)30(24,29(31)41-28)13-14-36(25)17-20-9-10-20/h4-8,11-12,20,23-25,29H,3,9-10,13-19H2,1-2H3/t23-,24?,25-,29-,30+,31?/m1/s1 |
| InChIKey | JXXASCGURLANHD-CKWCLHNMSA-N |
| XLogP | 5.60 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.72 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|