C26H33NO3 — CID 144657625
(7aR)-7-methoxy-3,4,12-trimethyl-9-phenylmethoxy-1,2,4,4a,5,6,7,7a-octahydro-[1]benzofuro[3,2-e]isoquinoline (PubChem CID 144657625) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is (7aR)-7-methoxy-3,4,12-trimethyl-9-phenylmethoxy-1,2,4,4a,5,6,7,7a-octahydro-[1]benzofuro[3,2-e]isoquinoline.
| Compound Name | (7aR)-7-methoxy-3,4,12-trimethyl-9-phenylmethoxy-1,2,4,4a,5,6,7,7a-octahydro-[1]benzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 144657625 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | (7aR)-7-methoxy-3,4,12-trimethyl-9-phenylmethoxy-1,2,4,4a,5,6,7,7a-octahydro-[1]benzofuro[3,2-e]isoquinoline |
| SMILES | COC1CCC2C(C)N(C)CCC23c2c(C)ccc(OCc4ccccc4)c2O[C@@H]13 |
| InChI | InChI=1S/C26H33NO3/c1-17-10-12-21(29-16-19-8-6-5-7-9-19)24-23(17)26-14-15-27(3)18(2)20(26)11-13-22(28-4)25(26)30-24/h5-10,12,18,20,22,25H,11,13-16H2,1-4H3/t18?,20?,22?,25-,26?/m0/s1 |
| InChIKey | FKAFDEVZOFXZPN-QINWVKCUSA-N |
| XLogP | 4.72 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |