C30H37NO4 — CID 144582137
acetylene;(8R,14R)-4,5,9,20-tetramethyl-17-phenylmethoxy-10,12,15-trioxa-4-azapentacyclo[12.7.0.01,6.08,13.016,21]henicosa-16,18,20-triene (PubChem CID 144582137) has the molecular formula C30H37NO4 and a molecular weight of 475.63 g/mol. Its IUPAC name is acetylene;(8R,14R)-4,5,9,20-tetramethyl-17-phenylmethoxy-10,12,15-trioxa-4-azapentacyclo[12.7.0.01,6.08,13.016,21]henicosa-16,18,20-triene.
| Compound Name | acetylene;(8R,14R)-4,5,9,20-tetramethyl-17-phenylmethoxy-10,12,15-trioxa-4-azapentacyclo[12.7.0.01,6.08,13.016,21]henicosa-16,18,20-triene |
|---|---|
| PubChem CID | 144582137 |
| Molecular Formula | C30H37NO4 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | acetylene;(8R,14R)-4,5,9,20-tetramethyl-17-phenylmethoxy-10,12,15-trioxa-4-azapentacyclo[12.7.0.01,6.08,13.016,21]henicosa-16,18,20-triene |
| SMILES | C#C.Cc1ccc(OCc2ccccc2)c2c1C13CCN(C)C(C)C1C[C@@H]1C(C)OCOC1[C@@H]3O2 |
| InChI | InChI=1S/C28H35NO4.C2H2/c1-17-10-11-23(30-15-20-8-6-5-7-9-20)26-24(17)28-12-13-29(4)18(2)22(28)14-21-19(3)31-16-32-25(21)27(28)33-26;1-2/h5-11,18-19,21-22,25,27H,12-16H2,1-4H3;1-2H/t18?,19?,21-,22?,25?,27+,28?;/m1./s1 |
| InChIKey | VSWCYKTTYVFHIU-UXBUWJPYSA-N |
| XLogP | 4.94 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|