C21H29NO4 — CID 144582107
(14R)-4,5,9,20-tetramethyl-10,12,15-trioxa-4-azapentacyclo[12.7.0.01,6.08,13.016,21]henicosa-16,18,20-trien-17-ol (PubChem CID 144582107) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is (14R)-4,5,9,20-tetramethyl-10,12,15-trioxa-4-azapentacyclo[12.7.0.01,6.08,13.016,21]henicosa-16,18,20-trien-17-ol.
| Compound Name | (14R)-4,5,9,20-tetramethyl-10,12,15-trioxa-4-azapentacyclo[12.7.0.01,6.08,13.016,21]henicosa-16,18,20-trien-17-ol |
|---|---|
| PubChem CID | 144582107 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | (14R)-4,5,9,20-tetramethyl-10,12,15-trioxa-4-azapentacyclo[12.7.0.01,6.08,13.016,21]henicosa-16,18,20-trien-17-ol |
| SMILES | Cc1ccc(O)c2c1C13CCN(C)C(C)C1CC1C(C)OCOC1[C@@H]3O2 |
| InChI | InChI=1S/C21H29NO4/c1-11-5-6-16(23)19-17(11)21-7-8-22(4)12(2)15(21)9-14-13(3)24-10-25-18(14)20(21)26-19/h5-6,12-15,18,20,23H,7-10H2,1-4H3/t12?,13?,14?,15?,18?,20-,21?/m0/s1 |
| InChIKey | JUQSARYGFGEANS-XVLAZVQFSA-N |
| XLogP | 2.82 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |