C34H47INO4 — CID 144582103
CID 144582103 (PubChem CID 144582103) has the molecular formula C34H47INO4 and a molecular weight of 660.66 g/mol.
| Compound Name | CID 144582103 |
|---|---|
| PubChem CID | 144582103 |
| Molecular Formula | C34H47INO4 |
| Molecular Weight | 660.66 g/mol |
| Exact Mass | 660.25 |
| IUPAC Name | — |
| SMILES | CCCC[I]C1OCOC2C[C@@]3(c4c(C)ccc(OCc5ccccc5)c4O)CCN(CC4CC4)C(C)C3C[C@@H]21 |
| InChI | InChI=1S/C34H47INO4/c1-4-5-16-35-33-27-18-28-24(3)36(20-25-12-13-25)17-15-34(28,19-30(27)39-22-40-33)31-23(2)11-14-29(32(31)37)38-21-26-9-7-6-8-10-26/h6-11,14,24-25,27-28,30,33,37H,4-5,12-13,15-22H2,1-3H3/t24?,27-,28?,30?,33?,34-/m0/s1 |
| InChIKey | QQJHLRYYFVLGFW-XDHNNCFVSA-N |
| XLogP | 7.52 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.66 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|