C27H35INO4 — CID 144582125
CID 144582125 (PubChem CID 144582125) has the molecular formula C27H35INO4 and a molecular weight of 564.48 g/mol.
| Compound Name | CID 144582125 |
|---|---|
| PubChem CID | 144582125 |
| Molecular Formula | C27H35INO4 |
| Molecular Weight | 564.48 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | — |
| SMILES | CCCC[I]C1OCOC2C1CC1C3N(CC4CC4)CC34Cc3ccc(O)c5c3C1(C4)[C@H]2O5 |
| InChI | InChI=1S/C27H35INO4/c1-2-3-8-28-25-17-9-18-23-26(13-29(23)11-15-4-5-15)10-16-6-7-19(30)22-20(16)27(18,12-26)24(33-22)21(17)31-14-32-25/h6-7,15,17-18,21,23-25,30H,2-5,8-14H2,1H3/t17?,18?,21?,23?,24-,25?,26?,27?/m0/s1 |
| InChIKey | JSBGCVHMSFFDJG-QQLJEFIRSA-N |
| XLogP | 4.54 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|