C30H40ClNO6 — CID 145271311
chloromethyl [(9R)-3-(cyclopropylmethyl)-7-(2-hydroxy-3,3-dimethylbutan-2-yl)-8-methoxy-10-oxa-3-azahexacyclo[13.3.1.01,4.05,17.09,17.011,16]nonadeca-11,13,15-trien-12-yl] carbonate (PubChem CID 145271311) has the molecular formula C30H40ClNO6 and a molecular weight of 546.10 g/mol. Its IUPAC name is chloromethyl [(9R)-3-(cyclopropylmethyl)-7-(2-hydroxy-3,3-dimethylbutan-2-yl)-8-methoxy-10-oxa-3-azahexacyclo[13.3.1.01,4.05,17.09,17.011,16]nonadeca-11,13,15-trien-12-yl] carbonate.
| Compound Name | chloromethyl [(9R)-3-(cyclopropylmethyl)-7-(2-hydroxy-3,3-dimethylbutan-2-yl)-8-methoxy-10-oxa-3-azahexacyclo[13.3.1.01,4.05,17.09,17.011,16]nonadeca-11,13,15-trien-12-yl] carbonate |
|---|---|
| PubChem CID | 145271311 |
| Molecular Formula | C30H40ClNO6 |
| Molecular Weight | 546.10 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | chloromethyl [(9R)-3-(cyclopropylmethyl)-7-(2-hydroxy-3,3-dimethylbutan-2-yl)-8-methoxy-10-oxa-3-azahexacyclo[13.3.1.01,4.05,17.09,17.011,16]nonadeca-11,13,15-trien-12-yl] carbonate |
| SMILES | COC1C(C(C)(O)C(C)(C)C)CC2C3N(CC4CC4)CC34Cc3ccc(OC(=O)OCCl)c5c3C2(C4)[C@H]1O5 |
| InChI | InChI=1S/C30H40ClNO6/c1-27(2,3)28(4,34)18-10-19-24-29(14-32(24)12-16-6-7-16)11-17-8-9-20(37-26(33)36-15-31)23-21(17)30(19,13-29)25(38-23)22(18)35-5/h8-9,16,18-19,22,24-25,34H,6-7,10-15H2,1-5H3/t18?,19?,22?,24?,25-,28?,29?,30?/m0/s1 |
| InChIKey | GIYBTBVZGFMRQK-JWOVKARESA-N |
| XLogP | 4.89 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.10 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|