C17H17NO3 — CID 59537242
(1R,3S,4R,8R,16S)-11-hydroxy-2-methyl-9-oxa-2-azahexacyclo[12.3.1.01,3.04,16.08,16.010,15]octadeca-10,12,14-trien-7-one (PubChem CID 59537242) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (1R,3S,4R,8R,16S)-11-hydroxy-2-methyl-9-oxa-2-azahexacyclo[12.3.1.01,3.04,16.08,16.010,15]octadeca-10,12,14-trien-7-one.
| Compound Name | (1R,3S,4R,8R,16S)-11-hydroxy-2-methyl-9-oxa-2-azahexacyclo[12.3.1.01,3.04,16.08,16.010,15]octadeca-10,12,14-trien-7-one |
|---|---|
| PubChem CID | 59537242 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (1R,3S,4R,8R,16S)-11-hydroxy-2-methyl-9-oxa-2-azahexacyclo[12.3.1.01,3.04,16.08,16.010,15]octadeca-10,12,14-trien-7-one |
| SMILES | CN1[C@H]2[C@@H]3CCC(=O)[C@@H]4Oc5c(O)ccc6c5[C@@]43C[C@]21C6 |
| InChI | InChI=1S/C17H17NO3/c1-18-14-9-3-5-11(20)15-17(9)7-16(14,18)6-8-2-4-10(19)13(21-15)12(8)17/h2,4,9,14-15,19H,3,5-7H2,1H3/t9-,14-,15-,16+,17-,18?/m0/s1 |
| InChIKey | ZYBIZNAMMGCVKN-YVMYKMNYSA-N |
| XLogP | 1.38 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|