C22H26N2O4 — CID 123548782
3-(cyclopropylmethyl)-5,8-dihydroxy-10-oxa-3-azahexacyclo[13.3.1.01,4.05,17.09,17.011,16]nonadeca-11,13,15-triene-12-carboxamide (PubChem CID 123548782) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-5,8-dihydroxy-10-oxa-3-azahexacyclo[13.3.1.01,4.05,17.09,17.011,16]nonadeca-11,13,15-triene-12-carboxamide.
| Compound Name | 3-(cyclopropylmethyl)-5,8-dihydroxy-10-oxa-3-azahexacyclo[13.3.1.01,4.05,17.09,17.011,16]nonadeca-11,13,15-triene-12-carboxamide |
|---|---|
| PubChem CID | 123548782 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 3-(cyclopropylmethyl)-5,8-dihydroxy-10-oxa-3-azahexacyclo[13.3.1.01,4.05,17.09,17.011,16]nonadeca-11,13,15-triene-12-carboxamide |
| SMILES | NC(=O)c1ccc2c3c1OC1C(O)CCC4(O)C5N(CC6CC6)CC5(C2)CC314 |
| InChI | InChI=1S/C22H26N2O4/c23-18(26)13-4-3-12-7-20-9-21-15(12)16(13)28-17(21)14(25)5-6-22(21,27)19(20)24(10-20)8-11-1-2-11/h3-4,11,14,17,19,25,27H,1-2,5-10H2,(H2,23,26) |
| InChIKey | BXFMIFCJHCJIQV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |