C30H37FN4O — CID 123396232
2-(3,4-dihydropyridin-5-yl)-6-(3-ethyl-4-fluorophenyl)-N-(5-iminohexyl)-8-methoxy-3-methyl-6,8a-dihydro-3H-quinolin-4-imine (PubChem CID 123396232) has the molecular formula C30H37FN4O and a molecular weight of 488.65 g/mol. Its IUPAC name is 2-(3,4-dihydropyridin-5-yl)-6-(3-ethyl-4-fluorophenyl)-N-(5-iminohexyl)-8-methoxy-3-methyl-6,8a-dihydro-3H-quinolin-4-imine.
| Compound Name | 2-(3,4-dihydropyridin-5-yl)-6-(3-ethyl-4-fluorophenyl)-N-(5-iminohexyl)-8-methoxy-3-methyl-6,8a-dihydro-3H-quinolin-4-imine |
|---|---|
| PubChem CID | 123396232 |
| Molecular Formula | C30H37FN4O |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | 2-(3,4-dihydropyridin-5-yl)-6-(3-ethyl-4-fluorophenyl)-N-(5-iminohexyl)-8-methoxy-3-methyl-6,8a-dihydro-3H-quinolin-4-imine |
| SMILES | [H]/N=C(\C)CCCC/N=C1/C2=CC(c3ccc(F)c(CC)c3)C=C(OC)C2N=C(C2=CN=CCC2)C1C |
| InChI | InChI=1S/C30H37FN4O/c1-5-21-15-22(11-12-26(21)31)24-16-25-29(34-14-7-6-9-19(2)32)20(3)28(23-10-8-13-33-18-23)35-30(25)27(17-24)36-4/h11-13,15-18,20,24,30,32H,5-10,14H2,1-4H3/b32-19+,34-29+ |
| InChIKey | CHOIFUMACRTSDW-VZNUECCESA-N |
| XLogP | 6.80 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|