C24H22F5N3O — CID 123520710
6-(3,4-difluorophenyl)-2-(2,5-dihydropyridin-3-yl)-8-methoxy-3-methyl-N-(2,2,2-trifluoroethyl)-6,8a-dihydro-3H-quinolin-4-imine (PubChem CID 123520710) has the molecular formula C24H22F5N3O and a molecular weight of 463.45 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-2-(2,5-dihydropyridin-3-yl)-8-methoxy-3-methyl-N-(2,2,2-trifluoroethyl)-6,8a-dihydro-3H-quinolin-4-imine.
| Compound Name | 6-(3,4-difluorophenyl)-2-(2,5-dihydropyridin-3-yl)-8-methoxy-3-methyl-N-(2,2,2-trifluoroethyl)-6,8a-dihydro-3H-quinolin-4-imine |
|---|---|
| PubChem CID | 123520710 |
| Molecular Formula | C24H22F5N3O |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 6-(3,4-difluorophenyl)-2-(2,5-dihydropyridin-3-yl)-8-methoxy-3-methyl-N-(2,2,2-trifluoroethyl)-6,8a-dihydro-3H-quinolin-4-imine |
| SMILES | COC1=CC(c2ccc(F)c(F)c2)C=C2/C(=N/CC(F)(F)F)C(C)C(C3=CCC=NC3)=NC12 |
| InChI | InChI=1S/C24H22F5N3O/c1-13-21(15-4-3-7-30-11-15)32-23-17(22(13)31-12-24(27,28)29)8-16(10-20(23)33-2)14-5-6-18(25)19(26)9-14/h4-10,13,16,23H,3,11-12H2,1-2H3/b31-22+ |
| InChIKey | REHJOOOLOOVTCO-DFKUXCBWSA-N |
| XLogP | 5.38 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|