C26H31FN2O — CID 123927495
N-butyl-2-cyclohexa-1,3-dien-1-yl-6-(3-fluorophenyl)-8-methoxy-6,7,8,8a-tetrahydro-3H-quinolin-4-imine (PubChem CID 123927495) has the molecular formula C26H31FN2O and a molecular weight of 406.55 g/mol. Its IUPAC name is N-butyl-2-cyclohexa-1,3-dien-1-yl-6-(3-fluorophenyl)-8-methoxy-6,7,8,8a-tetrahydro-3H-quinolin-4-imine.
| Compound Name | N-butyl-2-cyclohexa-1,3-dien-1-yl-6-(3-fluorophenyl)-8-methoxy-6,7,8,8a-tetrahydro-3H-quinolin-4-imine |
|---|---|
| PubChem CID | 123927495 |
| Molecular Formula | C26H31FN2O |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-butyl-2-cyclohexa-1,3-dien-1-yl-6-(3-fluorophenyl)-8-methoxy-6,7,8,8a-tetrahydro-3H-quinolin-4-imine |
| SMILES | CCCC/N=C1\CC(C2=CC=CCC2)=NC2C1=CC(c1cccc(F)c1)CC2OC |
| InChI | InChI=1S/C26H31FN2O/c1-3-4-13-28-24-17-23(18-9-6-5-7-10-18)29-26-22(24)15-20(16-25(26)30-2)19-11-8-12-21(27)14-19/h5-6,8-9,11-12,14-15,20,25-26H,3-4,7,10,13,16-17H2,1-2H3/b28-24+ |
| InChIKey | XHJWUFXBMPCTNR-ZZIIXHQDSA-N |
| XLogP | 5.99 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|