C18H19NO — CID 134863942
(4aS,10bS)-5-phenyl-3,4,4a,5,10a,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 134863942) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is (4aS,10bS)-5-phenyl-3,4,4a,5,10a,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,10bS)-5-phenyl-3,4,4a,5,10a,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 134863942 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (4aS,10bS)-5-phenyl-3,4,4a,5,10a,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | C1=CC2=NC(c3ccccc3)[C@@H]3CCCO[C@@H]3C2C=C1 |
| InChI | InChI=1S/C18H19NO/c1-2-7-13(8-3-1)17-15-10-6-12-20-18(15)14-9-4-5-11-16(14)19-17/h1-5,7-9,11,14-15,17-18H,6,10,12H2/t14?,15-,17?,18+/m0/s1 |
| InChIKey | HXYYXCGWTGVLOU-QZOMQWOVSA-N |
| XLogP | 3.72 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |