C12H15NO — CID 605013
2,5-dimethyl-4-phenyl-5,6-dihydro-4H-1,3-oxazine (PubChem CID 605013) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 2,5-dimethyl-4-phenyl-5,6-dihydro-4H-1,3-oxazine.
| Compound Name | 2,5-dimethyl-4-phenyl-5,6-dihydro-4H-1,3-oxazine |
|---|---|
| PubChem CID | 605013 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2,5-dimethyl-4-phenyl-5,6-dihydro-4H-1,3-oxazine |
| SMILES | CC1=NC(c2ccccc2)C(C)CO1 |
| InChI | InChI=1S/C12H15NO/c1-9-8-14-10(2)13-12(9)11-6-4-3-5-7-11/h3-7,9,12H,8H2,1-2H3 |
| InChIKey | JMBQLCDYWGQBHI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |