C16H23NO — CID 11470618
2,6,6-trimethyl-N-[(1R)-1-phenylethyl]oxan-3-imine (PubChem CID 11470618) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 2,6,6-trimethyl-N-[(1R)-1-phenylethyl]oxan-3-imine.
| Compound Name | 2,6,6-trimethyl-N-[(1R)-1-phenylethyl]oxan-3-imine |
|---|---|
| PubChem CID | 11470618 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 2,6,6-trimethyl-N-[(1R)-1-phenylethyl]oxan-3-imine |
| SMILES | CC1OC(C)(C)CC/C1=N\[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C16H23NO/c1-12(14-8-6-5-7-9-14)17-15-10-11-16(3,4)18-13(15)2/h5-9,12-13H,10-11H2,1-4H3/b17-15+/t12-,13?/m1/s1 |
| InChIKey | YPVUYTCACMTHPX-IFDBTWFKSA-N |
| XLogP | 4.17 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|