C17H21N3O2 — CID 57123772
N-benzyl-4-diazo-2,5-diethoxycyclohex-2-en-1-imine (PubChem CID 57123772) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-benzyl-4-diazo-2,5-diethoxycyclohex-2-en-1-imine.
| Compound Name | N-benzyl-4-diazo-2,5-diethoxycyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 57123772 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-benzyl-4-diazo-2,5-diethoxycyclohex-2-en-1-imine |
| SMILES | CCOC1=CC(=[N+]=[N-])C(OCC)C/C1=N\Cc1ccccc1 |
| InChI | InChI=1S/C17H21N3O2/c1-3-21-16-11-15(20-18)17(22-4-2)10-14(16)19-12-13-8-6-5-7-9-13/h5-9,11,17H,3-4,10,12H2,1-2H3/b19-14+ |
| InChIKey | YLGDRJJDKAANEG-XMHGGMMESA-N |
| XLogP | 3.03 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|