C23H28N2O — CID 171819501
2,4-diethyl-8-methoxy-2-methyl-N-(1-phenylethyl)quinolin-6-imine (PubChem CID 171819501) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is 2,4-diethyl-8-methoxy-2-methyl-N-(1-phenylethyl)quinolin-6-imine.
| Compound Name | 2,4-diethyl-8-methoxy-2-methyl-N-(1-phenylethyl)quinolin-6-imine |
|---|---|
| PubChem CID | 171819501 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 2,4-diethyl-8-methoxy-2-methyl-N-(1-phenylethyl)quinolin-6-imine |
| SMILES | CCC1=CC(C)(CC)N=C2C(OC)=C/C(=N\C(C)c3ccccc3)C=C12 |
| InChI | InChI=1S/C23H28N2O/c1-6-17-15-23(4,7-2)25-22-20(17)13-19(14-21(22)26-5)24-16(3)18-11-9-8-10-12-18/h8-16H,6-7H2,1-5H3/b24-19- |
| InChIKey | QQDLYCQYSJBKDA-CLCOLTQESA-N |
| XLogP | 5.62 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|