C18H18N2O2 — CID 139055197
(2R,5R)-3,6-dimethoxy-2,5-diphenyl-2,5-dihydropyrazine (PubChem CID 139055197) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is (2R,5R)-3,6-dimethoxy-2,5-diphenyl-2,5-dihydropyrazine.
| Compound Name | (2R,5R)-3,6-dimethoxy-2,5-diphenyl-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 139055197 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (2R,5R)-3,6-dimethoxy-2,5-diphenyl-2,5-dihydropyrazine |
| SMILES | COC1=N[C@H](c2ccccc2)C(OC)=N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H18N2O2/c1-21-17-15(13-9-5-3-6-10-13)20-18(22-2)16(19-17)14-11-7-4-8-12-14/h3-12,15-16H,1-2H3/t15-,16-/m1/s1 |
| InChIKey | AMSCJKBTRGICKY-HZPDHXFCSA-N |
| XLogP | 3.57 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |